C27H26O4 — CID 144989950
3-[2-[[3-[4-[(3E)-penta-1,3-dien-3-yl]phenoxy]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 144989950) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-[2-[[3-[4-[(3E)-penta-1,3-dien-3-yl]phenoxy]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[[3-[4-[(3E)-penta-1,3-dien-3-yl]phenoxy]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 144989950 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 3-[2-[[3-[4-[(3E)-penta-1,3-dien-3-yl]phenoxy]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | C=C/C(=C\C)c1ccc(Oc2cccc(COc3ccccc3CCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H26O4/c1-3-21(4-2)22-12-15-24(16-13-22)31-25-10-7-8-20(18-25)19-30-26-11-6-5-9-23(26)14-17-27(28)29/h3-13,15-16,18H,1,14,17,19H2,2H3,(H,28,29)/b21-4+ |
| InChIKey | PBYCVECTADIZAB-IPBDZQFASA-N |
| XLogP | 6.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|