C15H17BN2O5S2 — CID 144990849
(3R)-7-(cyclopropylmethoxy)-2-hydroxy-3-(C-methanimidoylsulfanylcarbonimidoyl)sulfanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 144990849) has the molecular formula C15H17BN2O5S2 and a molecular weight of 380.26 g/mol. Its IUPAC name is (3R)-7-(cyclopropylmethoxy)-2-hydroxy-3-(C-methanimidoylsulfanylcarbonimidoyl)sulfanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-7-(cyclopropylmethoxy)-2-hydroxy-3-(C-methanimidoylsulfanylcarbonimidoyl)sulfanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 144990849 |
| Molecular Formula | C15H17BN2O5S2 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (3R)-7-(cyclopropylmethoxy)-2-hydroxy-3-(C-methanimidoylsulfanylcarbonimidoyl)sulfanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | [H]/N=C(\S/C=N/[H])S[C@H]1Cc2ccc(OCC3CC3)c(C(=O)O)c2OB1O |
| InChI | InChI=1S/C15H17BN2O5S2/c17-7-24-15(18)25-11-5-9-3-4-10(22-6-8-1-2-8)12(14(19)20)13(9)23-16(11)21/h3-4,7-8,11,17-18,21H,1-2,5-6H2,(H,19,20)/b17-7+,18-15+/t11-/m0/s1 |
| InChIKey | YUPGRWQFQMJWKL-HITFCKIXSA-N |
| XLogP | 2.51 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|