C12H13BO7 — CID 174097167
2-hydroxy-7-(oxetan-3-ylmethoxy)-3H-1,4,2-benzodioxaborinine-8-carboxylic acid (PubChem CID 174097167) has the molecular formula C12H13BO7 and a molecular weight of 280.04 g/mol. Its IUPAC name is 2-hydroxy-7-(oxetan-3-ylmethoxy)-3H-1,4,2-benzodioxaborinine-8-carboxylic acid.
| Compound Name | 2-hydroxy-7-(oxetan-3-ylmethoxy)-3H-1,4,2-benzodioxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 174097167 |
| Molecular Formula | C12H13BO7 |
| Molecular Weight | 280.04 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-hydroxy-7-(oxetan-3-ylmethoxy)-3H-1,4,2-benzodioxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1c(OCC2COC2)ccc2c1OB(O)CO2 |
| InChI | InChI=1S/C12H13BO7/c14-12(15)10-8(18-5-7-3-17-4-7)1-2-9-11(10)20-13(16)6-19-9/h1-2,7,16H,3-6H2,(H,14,15) |
| InChIKey | VLOIKIZGJYWBOY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.04 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|