C20H13ClFN5O — CID 144991227
4-[5-chloro-1-(2,3-dimethylindazol-5-yl)-4-formylimidazol-2-yl]-2-fluorobenzonitrile (PubChem CID 144991227) has the molecular formula C20H13ClFN5O and a molecular weight of 393.81 g/mol. Its IUPAC name is 4-[5-chloro-1-(2,3-dimethylindazol-5-yl)-4-formylimidazol-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[5-chloro-1-(2,3-dimethylindazol-5-yl)-4-formylimidazol-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 144991227 |
| Molecular Formula | C20H13ClFN5O |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 4-[5-chloro-1-(2,3-dimethylindazol-5-yl)-4-formylimidazol-2-yl]-2-fluorobenzonitrile |
| SMILES | Cc1c2cc(-n3c(-c4ccc(C#N)c(F)c4)nc(C=O)c3Cl)ccc2nn1C |
| InChI | InChI=1S/C20H13ClFN5O/c1-11-15-8-14(5-6-17(15)25-26(11)2)27-19(21)18(10-28)24-20(27)12-3-4-13(9-23)16(22)7-12/h3-8,10H,1-2H3 |
| InChIKey | UKXAMRNJZNTYMB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|