C19H11F2N5O — CID 166907852
2-fluoro-4-[5-fluoro-4-formyl-1-(2-methylindazol-5-yl)imidazol-2-yl]benzonitrile (PubChem CID 166907852) has the molecular formula C19H11F2N5O and a molecular weight of 363.33 g/mol. Its IUPAC name is 2-fluoro-4-[5-fluoro-4-formyl-1-(2-methylindazol-5-yl)imidazol-2-yl]benzonitrile.
| Compound Name | 2-fluoro-4-[5-fluoro-4-formyl-1-(2-methylindazol-5-yl)imidazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 166907852 |
| Molecular Formula | C19H11F2N5O |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-fluoro-4-[5-fluoro-4-formyl-1-(2-methylindazol-5-yl)imidazol-2-yl]benzonitrile |
| SMILES | Cn1cc2cc(-n3c(-c4ccc(C#N)c(F)c4)nc(C=O)c3F)ccc2n1 |
| InChI | InChI=1S/C19H11F2N5O/c1-25-9-13-6-14(4-5-16(13)24-25)26-18(21)17(10-27)23-19(26)11-2-3-12(8-22)15(20)7-11/h2-7,9-10H,1H3 |
| InChIKey | OGXCCLCKBNIOCX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|