C24H22FN7 — CID 118920657
4-[6-(4-aminopiperidin-1-yl)-3-(2-methylindazol-5-yl)pyridazin-4-yl]-2-fluorobenzonitrile (PubChem CID 118920657) has the molecular formula C24H22FN7 and a molecular weight of 427.49 g/mol. Its IUPAC name is 4-[6-(4-aminopiperidin-1-yl)-3-(2-methylindazol-5-yl)pyridazin-4-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[6-(4-aminopiperidin-1-yl)-3-(2-methylindazol-5-yl)pyridazin-4-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 118920657 |
| Molecular Formula | C24H22FN7 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-[6-(4-aminopiperidin-1-yl)-3-(2-methylindazol-5-yl)pyridazin-4-yl]-2-fluorobenzonitrile |
| SMILES | Cn1cc2cc(-c3nnc(N4CCC(N)CC4)cc3-c3ccc(C#N)c(F)c3)ccc2n1 |
| InChI | InChI=1S/C24H22FN7/c1-31-14-18-10-16(4-5-22(18)30-31)24-20(15-2-3-17(13-26)21(25)11-15)12-23(28-29-24)32-8-6-19(27)7-9-32/h2-5,10-12,14,19H,6-9,27H2,1H3 |
| InChIKey | NGVLEPCITBWZPO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |