C25H23FN6 — CID 118920627
4-[2-(4-aminopiperidin-1-yl)-5-(2-methylindazol-5-yl)-4-pyridinyl]-2-fluorobenzonitrile (PubChem CID 118920627) has the molecular formula C25H23FN6 and a molecular weight of 426.50 g/mol. Its IUPAC name is 4-[2-(4-aminopiperidin-1-yl)-5-(2-methylindazol-5-yl)-4-pyridinyl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-(4-aminopiperidin-1-yl)-5-(2-methylindazol-5-yl)-4-pyridinyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 118920627 |
| Molecular Formula | C25H23FN6 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 4-[2-(4-aminopiperidin-1-yl)-5-(2-methylindazol-5-yl)-4-pyridinyl]-2-fluorobenzonitrile |
| SMILES | Cn1cc2cc(-c3cnc(N4CCC(N)CC4)cc3-c3ccc(C#N)c(F)c3)ccc2n1 |
| InChI | InChI=1S/C25H23FN6/c1-31-15-19-10-16(4-5-24(19)30-31)22-14-29-25(32-8-6-20(28)7-9-32)12-21(22)17-2-3-18(13-27)23(26)11-17/h2-5,10-12,14-15,20H,6-9,28H2,1H3 |
| InChIKey | ATYRWNSAJNMKTB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |