About 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile
4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile (PubChem CID 166907779) has the molecular formula C21H17FN4
and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile |
| PubChem CID | 166907779 |
| Molecular Formula | C21H17FN4 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile |
| SMILES | Cc1cc(-c2ccc(C#N)c(F)c2)c(-c2ccc3nn(C)cc3c2)n1C |
| InChI | InChI=1S/C21H17FN4/c1-13-8-18(14-4-5-16(11-23)19(22)10-14)21(26(13)3)15-6-7-20-17(9-15)12-25(2)24-20/h4-10,12H,1-3H3 |
| InChIKey | LUSGTBCQQYQHKV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile?
The IUPAC name of 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile (CID 166907779) is 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile.
What is the SMILES notation for 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile?
The canonical SMILES for 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile is Cc1cc(-c2ccc(C#N)c(F)c2)c(-c2ccc3nn(C)cc3c2)n1C.
What is the InChIKey of 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile?
The InChIKey is LUSGTBCQQYQHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FN4/c1-13-8-18(14-4-5-16(11-23)19(22)10-14)21(26(13)3)15-6-7-20-17(9-15)12-25(2)24-20/h4-10,12H,1-3H3.
What are the key properties of 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile?
4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile has a molecular weight of 344.39 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,5-dimethyl-2-(2-methylindazol-5-yl)pyrrol-3-yl]-2-fluorobenzonitrile is sourced from PubChem (CID 166907779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).