About 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile
4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile (PubChem CID 122622013) has the molecular formula C24H22FN7
and a molecular weight of 427.49 g/mol. Its IUPAC name is 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile |
| PubChem CID | 122622013 |
| Molecular Formula | C24H22FN7 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile |
| SMILES | Cn1cc2cc(-c3cnc(N4CCCNCC4)nc3-c3ccc(C#N)c(F)c3)ccc2n1 |
| InChI | InChI=1S/C24H22FN7/c1-31-15-19-11-16(5-6-22(19)30-31)20-14-28-24(32-9-2-7-27-8-10-32)29-23(20)17-3-4-18(13-26)21(25)12-17/h3-6,11-12,14-15,27H,2,7-10H2,1H3 |
| InChIKey | OUSGZXFWFLYBBH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 82.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile?
The IUPAC name of 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile (CID 122622013) is 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile.
What is the SMILES notation for 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile?
The canonical SMILES for 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile is Cn1cc2cc(-c3cnc(N4CCCNCC4)nc3-c3ccc(C#N)c(F)c3)ccc2n1.
What is the InChIKey of 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile?
The InChIKey is OUSGZXFWFLYBBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22FN7/c1-31-15-19-11-16(5-6-22(19)30-31)20-14-28-24(32-9-2-7-27-8-10-32)29-23(20)17-3-4-18(13-26)21(25)12-17/h3-6,11-12,14-15,27H,2,7-10H2,1H3.
What are the key properties of 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile?
4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile has a molecular weight of 427.49 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,4-diazepan-1-yl)-5-(2-methylindazol-5-yl)pyrimidin-4-yl]-2-fluorobenzonitrile is sourced from PubChem (CID 122622013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).