C14H25ClN2 — CID 144991470
(2E)-2-chloro-3,5-dimethylhexa-2,4-diene;N'-methyl-N-(2-methylprop-1-enyl)methanimidamide (PubChem CID 144991470) has the molecular formula C14H25ClN2 and a molecular weight of 256.82 g/mol. Its IUPAC name is (2E)-2-chloro-3,5-dimethylhexa-2,4-diene;N'-methyl-N-(2-methylprop-1-enyl)methanimidamide.
| Compound Name | (2E)-2-chloro-3,5-dimethylhexa-2,4-diene;N'-methyl-N-(2-methylprop-1-enyl)methanimidamide |
|---|---|
| PubChem CID | 144991470 |
| Molecular Formula | C14H25ClN2 |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (2E)-2-chloro-3,5-dimethylhexa-2,4-diene;N'-methyl-N-(2-methylprop-1-enyl)methanimidamide |
| SMILES | C/N=C/NC=C(C)C.CC(C)=C/C(C)=C(\C)Cl |
| InChI | InChI=1S/C8H13Cl.C6H12N2/c1-6(2)5-7(3)8(4)9;1-6(2)4-8-5-7-3/h5H,1-4H3;4-5H,1-3H3,(H,7,8)/b8-7+; |
| InChIKey | HBBTXWRQWLYYBT-USRGLUTNSA-N |
| XLogP | 4.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|