C11H19ClN2 — CID 143160526
N-[(3Z,5E)-5-chloro-2,2-dimethylhepta-3,5-dienyl]-N'-methylmethanimidamide (PubChem CID 143160526) has the molecular formula C11H19ClN2 and a molecular weight of 214.74 g/mol. Its IUPAC name is N-[(3Z,5E)-5-chloro-2,2-dimethylhepta-3,5-dienyl]-N'-methylmethanimidamide.
| Compound Name | N-[(3Z,5E)-5-chloro-2,2-dimethylhepta-3,5-dienyl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 143160526 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | N-[(3Z,5E)-5-chloro-2,2-dimethylhepta-3,5-dienyl]-N'-methylmethanimidamide |
| SMILES | C/C=C(Cl)\C=C/C(C)(C)CN/C=N/C |
| InChI | InChI=1S/C11H19ClN2/c1-5-10(12)6-7-11(2,3)8-14-9-13-4/h5-7,9H,8H2,1-4H3,(H,13,14)/b7-6-,10-5+ |
| InChIKey | SIUWPTGIFMWIHE-JQEGGOPCSA-N |
| XLogP | 2.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|