C11H14O — CID 144994439
3-[(1E)-3-methylidenepenta-1,4-dienyl]cyclopentan-1-one (PubChem CID 144994439) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-[(1E)-3-methylidenepenta-1,4-dienyl]cyclopentan-1-one.
| Compound Name | 3-[(1E)-3-methylidenepenta-1,4-dienyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 144994439 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3-[(1E)-3-methylidenepenta-1,4-dienyl]cyclopentan-1-one |
| SMILES | C=CC(=C)/C=C/C1CCC(=O)C1 |
| InChI | InChI=1S/C11H14O/c1-3-9(2)4-5-10-6-7-11(12)8-10/h3-5,10H,1-2,6-8H2/b5-4+ |
| InChIKey | ZAPNROSMMFSYKR-SNAWJCMRSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|