C23H33F3NOS2+ — CID 144994521
1-(4-cyclohexylphenyl)-3,3-dimethyl-2-[4-(trifluoromethylsulfanyl)thiomorpholin-1-ium-1-yl]butan-1-one (PubChem CID 144994521) has the molecular formula C23H33F3NOS2+ and a molecular weight of 460.65 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-3,3-dimethyl-2-[4-(trifluoromethylsulfanyl)thiomorpholin-1-ium-1-yl]butan-1-one.
| Compound Name | 1-(4-cyclohexylphenyl)-3,3-dimethyl-2-[4-(trifluoromethylsulfanyl)thiomorpholin-1-ium-1-yl]butan-1-one |
|---|---|
| PubChem CID | 144994521 |
| Molecular Formula | C23H33F3NOS2+ |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-3,3-dimethyl-2-[4-(trifluoromethylsulfanyl)thiomorpholin-1-ium-1-yl]butan-1-one |
| SMILES | CC(C)(C)C(C(=O)c1ccc(C2CCCCC2)cc1)[S+]1CCN(SC(F)(F)F)CC1 |
| InChI | InChI=1S/C23H33F3NOS2/c1-22(2,3)21(30-15-13-27(14-16-30)29-23(24,25)26)20(28)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h9-12,17,21H,4-8,13-16H2,1-3H3/q+1 |
| InChIKey | MXNRKEMEHXYHCU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|