C23H35NO — CID 144994558
N,N-dicyclohexyl-3-methyl-3-phenylbutanamide (PubChem CID 144994558) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is N,N-dicyclohexyl-3-methyl-3-phenylbutanamide.
| Compound Name | N,N-dicyclohexyl-3-methyl-3-phenylbutanamide |
|---|---|
| PubChem CID | 144994558 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | N,N-dicyclohexyl-3-methyl-3-phenylbutanamide |
| SMILES | CC(C)(CC(=O)N(C1CCCCC1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H35NO/c1-23(2,19-12-6-3-7-13-19)18-22(25)24(20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3,6-7,12-13,20-21H,4-5,8-11,14-18H2,1-2H3 |
| InChIKey | HNZOEYGOWFZBIZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |