About N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine
N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine (PubChem CID 144994822) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine |
| PubChem CID | 144994822 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine |
| SMILES | C=C(NCCC)C1CNc2ccccc2O1 |
| InChI | InChI=1S/C13H18N2O/c1-3-8-14-10(2)13-9-15-11-6-4-5-7-12(11)16-13/h4-7,13-15H,2-3,8-9H2,1H3 |
| InChIKey | CUNOHVPATJIINN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine?
The IUPAC name of N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine (CID 144994822) is N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine.
What is the SMILES notation for N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine?
The canonical SMILES for N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine is C=C(NCCC)C1CNc2ccccc2O1.
What is the InChIKey of N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine?
The InChIKey is CUNOHVPATJIINN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-3-8-14-10(2)13-9-15-11-6-4-5-7-12(11)16-13/h4-7,13-15H,2-3,8-9H2,1H3.
What are the key properties of N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine?
N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine has a molecular weight of 218.30 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dihydro-2H-1,4-benzoxazin-2-yl)ethenyl]propan-1-amine is sourced from PubChem (CID 144994822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).