C19H28N2O3S — CID 144996612
ethane;3-[3-[(5-methyl-6-sulfanylidene-1H-pyrazin-2-yl)methoxy]phenyl]propanoic acid (PubChem CID 144996612) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is ethane;3-[3-[(5-methyl-6-sulfanylidene-1H-pyrazin-2-yl)methoxy]phenyl]propanoic acid.
| Compound Name | ethane;3-[3-[(5-methyl-6-sulfanylidene-1H-pyrazin-2-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 144996612 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | ethane;3-[3-[(5-methyl-6-sulfanylidene-1H-pyrazin-2-yl)methoxy]phenyl]propanoic acid |
| SMILES | CC.CC.Cc1ncc(COc2cccc(CCC(=O)O)c2)[nH]c1=S |
| InChI | InChI=1S/C15H16N2O3S.2C2H6/c1-10-15(21)17-12(8-16-10)9-20-13-4-2-3-11(7-13)5-6-14(18)19;2*1-2/h2-4,7-8H,5-6,9H2,1H3,(H,17,21)(H,18,19);2*1-2H3 |
| InChIKey | CUWPMCZZRPJCRJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|