C12H26N2O2 — CID 144997349
N-methylethanamine;4-methyl-N-(1-oxopropan-2-yl)pentanamide (PubChem CID 144997349) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-methylethanamine;4-methyl-N-(1-oxopropan-2-yl)pentanamide.
| Compound Name | N-methylethanamine;4-methyl-N-(1-oxopropan-2-yl)pentanamide |
|---|---|
| PubChem CID | 144997349 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | N-methylethanamine;4-methyl-N-(1-oxopropan-2-yl)pentanamide |
| SMILES | CC(C)CCC(=O)NC(C)C=O.CCNC |
| InChI | InChI=1S/C9H17NO2.C3H9N/c1-7(2)4-5-9(12)10-8(3)6-11;1-3-4-2/h6-8H,4-5H2,1-3H3,(H,10,12);4H,3H2,1-2H3 |
| InChIKey | DQUYSRILNOEQON-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|