C14H30N4O3 — CID 178090758
2-acetamido-6-amino-N-(1-oxopropan-2-yl)hexanamide;N-methylethanamine (PubChem CID 178090758) has the molecular formula C14H30N4O3 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-acetamido-6-amino-N-(1-oxopropan-2-yl)hexanamide;N-methylethanamine.
| Compound Name | 2-acetamido-6-amino-N-(1-oxopropan-2-yl)hexanamide;N-methylethanamine |
|---|---|
| PubChem CID | 178090758 |
| Molecular Formula | C14H30N4O3 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | 2-acetamido-6-amino-N-(1-oxopropan-2-yl)hexanamide;N-methylethanamine |
| SMILES | CC(=O)NC(CCCCN)C(=O)NC(C)C=O.CCNC |
| InChI | InChI=1S/C11H21N3O3.C3H9N/c1-8(7-15)13-11(17)10(14-9(2)16)5-3-4-6-12;1-3-4-2/h7-8,10H,3-6,12H2,1-2H3,(H,13,17)(H,14,16);4H,3H2,1-2H3 |
| InChIKey | FAQJSWLEBKVYTR-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|