C14H21N3 — CID 144998018
2,8,8-trimethyl-2-propan-2-ylpyrimido[1,2-b]diazepine (PubChem CID 144998018) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2,8,8-trimethyl-2-propan-2-ylpyrimido[1,2-b]diazepine.
| Compound Name | 2,8,8-trimethyl-2-propan-2-ylpyrimido[1,2-b]diazepine |
|---|---|
| PubChem CID | 144998018 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 2,8,8-trimethyl-2-propan-2-ylpyrimido[1,2-b]diazepine |
| SMILES | CC(C)C1(C)C=CN2N=CC(C)(C)C=CC2=N1 |
| InChI | InChI=1S/C14H21N3/c1-11(2)14(5)8-9-17-12(16-14)6-7-13(3,4)10-15-17/h6-11H,1-5H3 |
| InChIKey | FUUHPMLMPJZAKR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |