C16H25N3 — CID 144812681
2,8-dimethyl-2,8-di(propan-2-yl)pyrimido[1,2-b]diazepine (PubChem CID 144812681) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2,8-dimethyl-2,8-di(propan-2-yl)pyrimido[1,2-b]diazepine.
| Compound Name | 2,8-dimethyl-2,8-di(propan-2-yl)pyrimido[1,2-b]diazepine |
|---|---|
| PubChem CID | 144812681 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2,8-dimethyl-2,8-di(propan-2-yl)pyrimido[1,2-b]diazepine |
| SMILES | CC(C)C1(C)C=CC2=NC(C)(C(C)C)C=CN2N=C1 |
| InChI | InChI=1S/C16H25N3/c1-12(2)15(5)8-7-14-18-16(6,13(3)4)9-10-19(14)17-11-15/h7-13H,1-6H3 |
| InChIKey | PTNLJCGPWHFJTF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |