C16H24N2 — CID 144997999
2-tert-butyl-2,8,8-trimethylpyrimido[1,2-a]azepine (PubChem CID 144997999) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-tert-butyl-2,8,8-trimethylpyrimido[1,2-a]azepine.
| Compound Name | 2-tert-butyl-2,8,8-trimethylpyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 144997999 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-tert-butyl-2,8,8-trimethylpyrimido[1,2-a]azepine |
| SMILES | CC1(C)C=CC2=NC(C)(C(C)(C)C)C=CN2C=C1 |
| InChI | InChI=1S/C16H24N2/c1-14(2,3)16(6)10-12-18-11-9-15(4,5)8-7-13(18)17-16/h7-12H,1-6H3 |
| InChIKey | MRXWKHAWMAMJKQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |