C17H29N3 — CID 144998076
[4-methyl-4-propan-2-yl-2-[(Z)-3,4,4-trimethylpent-1-enyl]pyrimidin-1-yl]methanimine (PubChem CID 144998076) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is [4-methyl-4-propan-2-yl-2-[(Z)-3,4,4-trimethylpent-1-enyl]pyrimidin-1-yl]methanimine.
| Compound Name | [4-methyl-4-propan-2-yl-2-[(Z)-3,4,4-trimethylpent-1-enyl]pyrimidin-1-yl]methanimine |
|---|---|
| PubChem CID | 144998076 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | [4-methyl-4-propan-2-yl-2-[(Z)-3,4,4-trimethylpent-1-enyl]pyrimidin-1-yl]methanimine |
| SMILES | [H]/N=C/N1C=CC(C)(C(C)C)N=C1/C=C\C(C)C(C)(C)C |
| InChI | InChI=1S/C17H29N3/c1-13(2)17(7)10-11-20(12-18)15(19-17)9-8-14(3)16(4,5)6/h8-14,18H,1-7H3/b9-8-,18-12+ |
| InChIKey | HROWMJXUOUCKNP-DOVXYIQDSA-N |
| XLogP | 4.47 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|