C15H25N3 — CID 144812696
[2-[(Z)-3,4-dimethylpent-1-enyl]-5-propan-2-yl-4H-pyrimidin-1-yl]methanimine (PubChem CID 144812696) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is [2-[(Z)-3,4-dimethylpent-1-enyl]-5-propan-2-yl-4H-pyrimidin-1-yl]methanimine.
| Compound Name | [2-[(Z)-3,4-dimethylpent-1-enyl]-5-propan-2-yl-4H-pyrimidin-1-yl]methanimine |
|---|---|
| PubChem CID | 144812696 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | [2-[(Z)-3,4-dimethylpent-1-enyl]-5-propan-2-yl-4H-pyrimidin-1-yl]methanimine |
| SMILES | [H]/N=C/N1C=C(C(C)C)CN=C1/C=C\C(C)C(C)C |
| InChI | InChI=1S/C15H25N3/c1-11(2)13(5)6-7-15-17-8-14(12(3)4)9-18(15)10-16/h6-7,9-13,16H,8H2,1-5H3/b7-6-,16-10+ |
| InChIKey | LGIDFWVYAUAJNM-XVRBRGRQSA-N |
| XLogP | 3.70 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|