C19H37N3 — CID 144812695
[2-[(Z)-3,4-dimethylpent-1-enyl]-5-propan-2-yl-4H-pyrimidin-1-yl]methanimine;ethane (PubChem CID 144812695) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is [2-[(Z)-3,4-dimethylpent-1-enyl]-5-propan-2-yl-4H-pyrimidin-1-yl]methanimine;ethane.
| Compound Name | [2-[(Z)-3,4-dimethylpent-1-enyl]-5-propan-2-yl-4H-pyrimidin-1-yl]methanimine;ethane |
|---|---|
| PubChem CID | 144812695 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | [2-[(Z)-3,4-dimethylpent-1-enyl]-5-propan-2-yl-4H-pyrimidin-1-yl]methanimine;ethane |
| SMILES | CC.CC.[H]/N=C/N1C=C(C(C)C)CN=C1/C=C\C(C)C(C)C |
| InChI | InChI=1S/C15H25N3.2C2H6/c1-11(2)13(5)6-7-15-17-8-14(12(3)4)9-18(15)10-16;2*1-2/h6-7,9-13,16H,8H2,1-5H3;2*1-2H3/b7-6-,16-10+;; |
| InChIKey | UHOANSNVVGYJLK-MOYBKCQWSA-N |
| XLogP | 5.75 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|