C16H27N3 — CID 144998032
[2-[(Z)-3,4-dimethylpent-1-enyl]-4-methyl-4-propan-2-ylpyrimidin-1-yl]methanimine (PubChem CID 144998032) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is [2-[(Z)-3,4-dimethylpent-1-enyl]-4-methyl-4-propan-2-ylpyrimidin-1-yl]methanimine.
| Compound Name | [2-[(Z)-3,4-dimethylpent-1-enyl]-4-methyl-4-propan-2-ylpyrimidin-1-yl]methanimine |
|---|---|
| PubChem CID | 144998032 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | [2-[(Z)-3,4-dimethylpent-1-enyl]-4-methyl-4-propan-2-ylpyrimidin-1-yl]methanimine |
| SMILES | [H]/N=C/N1C=CC(C)(C(C)C)N=C1/C=C\C(C)C(C)C |
| InChI | InChI=1S/C16H27N3/c1-12(2)14(5)7-8-15-18-16(6,13(3)4)9-10-19(15)11-17/h7-14,17H,1-6H3/b8-7-,17-11+ |
| InChIKey | ZPQMNECOFHPTOT-IOERDVGBSA-N |
| XLogP | 4.08 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|