C16H29N3 — CID 144997948
[2-[(Z)-3,4-dimethylpent-1-enyl]-4,4-dimethylpyrimidin-1-yl]methanimine;ethane (PubChem CID 144997948) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is [2-[(Z)-3,4-dimethylpent-1-enyl]-4,4-dimethylpyrimidin-1-yl]methanimine;ethane.
| Compound Name | [2-[(Z)-3,4-dimethylpent-1-enyl]-4,4-dimethylpyrimidin-1-yl]methanimine;ethane |
|---|---|
| PubChem CID | 144997948 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | [2-[(Z)-3,4-dimethylpent-1-enyl]-4,4-dimethylpyrimidin-1-yl]methanimine;ethane |
| SMILES | CC.[H]/N=C/N1C=CC(C)(C)N=C1/C=C\C(C)C(C)C |
| InChI | InChI=1S/C14H23N3.C2H6/c1-11(2)12(3)6-7-13-16-14(4,5)8-9-17(13)10-15;1-2/h6-12,15H,1-5H3;1-2H3/b7-6-,15-10+; |
| InChIKey | NDXNECXDJONQJX-AISWBYLUSA-N |
| XLogP | 4.47 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|