C20H38N2 — CID 144812745
1-[(Z)-3,4-dimethylpent-1-enyl]-5-ethyl-5-methylazepin-2-imine;ethane (PubChem CID 144812745) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 1-[(Z)-3,4-dimethylpent-1-enyl]-5-ethyl-5-methylazepin-2-imine;ethane.
| Compound Name | 1-[(Z)-3,4-dimethylpent-1-enyl]-5-ethyl-5-methylazepin-2-imine;ethane |
|---|---|
| PubChem CID | 144812745 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | 1-[(Z)-3,4-dimethylpent-1-enyl]-5-ethyl-5-methylazepin-2-imine;ethane |
| SMILES | CC.CC.[H]/N=C1\C=CC(C)(CC)C=CN1/C=C\C(C)C(C)C |
| InChI | InChI=1S/C16H26N2.2C2H6/c1-6-16(5)9-7-15(17)18(12-10-16)11-8-14(4)13(2)3;2*1-2/h7-14,17H,6H2,1-5H3;2*1-2H3/b11-8-,17-15+;; |
| InChIKey | HZNHJLXMAQHHNL-UULNAHNQSA-N |
| XLogP | 6.62 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|