C22H30N2 — CID 143288207
1-[(1E,4E,8Z)-2,3,3,6,6-pentamethyl-7-methylideneundeca-1,4,8,10-tetraenyl]pyridin-2-imine (PubChem CID 143288207) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-[(1E,4E,8Z)-2,3,3,6,6-pentamethyl-7-methylideneundeca-1,4,8,10-tetraenyl]pyridin-2-imine.
| Compound Name | 1-[(1E,4E,8Z)-2,3,3,6,6-pentamethyl-7-methylideneundeca-1,4,8,10-tetraenyl]pyridin-2-imine |
|---|---|
| PubChem CID | 143288207 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[(1E,4E,8Z)-2,3,3,6,6-pentamethyl-7-methylideneundeca-1,4,8,10-tetraenyl]pyridin-2-imine |
| SMILES | [H]/N=c1\ccccn1/C=C(\C)C(C)(C)/C=C/C(C)(C)C(=C)/C=C\C=C |
| InChI | InChI=1S/C22H30N2/c1-8-9-12-18(2)21(4,5)14-15-22(6,7)19(3)17-24-16-11-10-13-20(24)23/h8-17,23H,1-2H2,3-7H3/b12-9-,15-14+,19-17+,23-20+ |
| InChIKey | TZYOEGBHNNGRPH-KDUOIVIYSA-N |
| XLogP | 5.74 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|