C20H14F4N4O2 — CID 144998404
methyl 3-[[5-(2-fluorophenyl)pyrimidin-2-yl]amino]-4-(2,2,2-trifluoroethanimidoyl)benzoate (PubChem CID 144998404) has the molecular formula C20H14F4N4O2 and a molecular weight of 418.35 g/mol. Its IUPAC name is methyl 3-[[5-(2-fluorophenyl)pyrimidin-2-yl]amino]-4-(2,2,2-trifluoroethanimidoyl)benzoate.
| Compound Name | methyl 3-[[5-(2-fluorophenyl)pyrimidin-2-yl]amino]-4-(2,2,2-trifluoroethanimidoyl)benzoate |
|---|---|
| PubChem CID | 144998404 |
| Molecular Formula | C20H14F4N4O2 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | methyl 3-[[5-(2-fluorophenyl)pyrimidin-2-yl]amino]-4-(2,2,2-trifluoroethanimidoyl)benzoate |
| SMILES | [H]/N=C(/c1ccc(C(=O)OC)cc1Nc1ncc(-c2ccccc2F)cn1)C(F)(F)F |
| InChI | InChI=1S/C20H14F4N4O2/c1-30-18(29)11-6-7-14(17(25)20(22,23)24)16(8-11)28-19-26-9-12(10-27-19)13-4-2-3-5-15(13)21/h2-10,25H,1H3,(H,26,27,28)/b25-17- |
| InChIKey | MCCRIEBCERIZED-UQQQWYQISA-N |
| XLogP | 4.74 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|