C21H22BrN2O4S+ — CID 145001514
4-[[4-[(1-amino-2-bromopyridin-1-ium-3-yl)oxymethyl]phenyl]methyl]-2,6-dimethylbenzenesulfonic acid (PubChem CID 145001514) has the molecular formula C21H22BrN2O4S+ and a molecular weight of 478.39 g/mol. Its IUPAC name is 4-[[4-[(1-amino-2-bromopyridin-1-ium-3-yl)oxymethyl]phenyl]methyl]-2,6-dimethylbenzenesulfonic acid.
| Compound Name | 4-[[4-[(1-amino-2-bromopyridin-1-ium-3-yl)oxymethyl]phenyl]methyl]-2,6-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 145001514 |
| Molecular Formula | C21H22BrN2O4S+ |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 4-[[4-[(1-amino-2-bromopyridin-1-ium-3-yl)oxymethyl]phenyl]methyl]-2,6-dimethylbenzenesulfonic acid |
| SMILES | Cc1cc(Cc2ccc(COc3ccc[n+](N)c3Br)cc2)cc(C)c1S(=O)(=O)O |
| InChI | InChI=1S/C21H21BrN2O4S/c1-14-10-18(11-15(2)20(14)29(25,26)27)12-16-5-7-17(8-6-16)13-28-19-4-3-9-24(23)21(19)22/h3-11H,12-13,23H2,1-2H3/p+1 |
| InChIKey | HOSREBAYGTWPEF-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|