About N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane
N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane (PubChem CID 145002499) has the molecular formula C17H24BrN3
and a molecular weight of 350.30 g/mol. Its IUPAC name is N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane.
Molecular Properties
| Compound Name | N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane |
| PubChem CID | 145002499 |
| Molecular Formula | C17H24BrN3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane |
| SMILES | CC.CC.[H]/N=C/c1ccc(Br)cc1Nc1cccc(C)n1 |
| InChI | InChI=1S/C13H12BrN3.2C2H6/c1-9-3-2-4-13(16-9)17-12-7-11(14)6-5-10(12)8-15;2*1-2/h2-8,15H,1H3,(H,16,17);2*1-2H3/b15-8+;; |
| InChIKey | DTZXIOBPAHCVKH-OLIKVXRNSA-N |
| XLogP | 5.95 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane?
The IUPAC name of N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane (CID 145002499) is N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane.
What is the SMILES notation for N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane?
The canonical SMILES for N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane is CC.CC.[H]/N=C/c1ccc(Br)cc1Nc1cccc(C)n1.
What is the InChIKey of N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane?
The InChIKey is DTZXIOBPAHCVKH-OLIKVXRNSA-N. The full InChI is InChI=1S/C13H12BrN3.2C2H6/c1-9-3-2-4-13(16-9)17-12-7-11(14)6-5-10(12)8-15;2*1-2/h2-8,15H,1H3,(H,16,17);2*1-2H3/b15-8+;;.
What are the key properties of N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane?
N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane has a molecular weight of 350.30 g/mol, XLogP of 5.95, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2-methanimidoylphenyl)-6-methylpyridin-2-amine;ethane is sourced from PubChem (CID 145002499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).