C24H30N4S — CID 145005321
(Z)-1-[1-[[1-(2-phenylethylsulfanyl)piperidin-4-yl]methyl]indol-5-yl]ethene-1,2-diamine (PubChem CID 145005321) has the molecular formula C24H30N4S and a molecular weight of 406.60 g/mol. Its IUPAC name is (Z)-1-[1-[[1-(2-phenylethylsulfanyl)piperidin-4-yl]methyl]indol-5-yl]ethene-1,2-diamine.
| Compound Name | (Z)-1-[1-[[1-(2-phenylethylsulfanyl)piperidin-4-yl]methyl]indol-5-yl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 145005321 |
| Molecular Formula | C24H30N4S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | (Z)-1-[1-[[1-(2-phenylethylsulfanyl)piperidin-4-yl]methyl]indol-5-yl]ethene-1,2-diamine |
| SMILES | N/C=C(\N)c1ccc2c(ccn2CC2CCN(SCCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H30N4S/c25-17-23(26)21-6-7-24-22(16-21)10-12-27(24)18-20-8-13-28(14-9-20)29-15-11-19-4-2-1-3-5-19/h1-7,10,12,16-17,20H,8-9,11,13-15,18,25-26H2/b23-17- |
| InChIKey | SXAADBCXLAIEFB-QJOMJCCJSA-N |
| XLogP | 4.46 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|