C23H24N2O2 — CID 23636399
ethyl (E)-3-[[1-(cyclopropylmethyl)indol-5-yl]amino]-3-phenylprop-2-enoate (PubChem CID 23636399) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is ethyl (E)-3-[[1-(cyclopropylmethyl)indol-5-yl]amino]-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-3-[[1-(cyclopropylmethyl)indol-5-yl]amino]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 23636399 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl (E)-3-[[1-(cyclopropylmethyl)indol-5-yl]amino]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C=C(/Nc1ccc2c(ccn2CC2CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c1-2-27-23(26)15-21(18-6-4-3-5-7-18)24-20-10-11-22-19(14-20)12-13-25(22)16-17-8-9-17/h3-7,10-15,17,24H,2,8-9,16H2,1H3/b21-15+ |
| InChIKey | OQXXQGLYUKWMGT-RCCKNPSSSA-N |
| XLogP | 5.07 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|