C16H25N3O3 — CID 145005804
2-benzylpyrrolidine;2-formamido-3-hydroxybutanamide (PubChem CID 145005804) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-benzylpyrrolidine;2-formamido-3-hydroxybutanamide.
| Compound Name | 2-benzylpyrrolidine;2-formamido-3-hydroxybutanamide |
|---|---|
| PubChem CID | 145005804 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-benzylpyrrolidine;2-formamido-3-hydroxybutanamide |
| SMILES | CC(O)C(NC=O)C(N)=O.c1ccc(CC2CCCN2)cc1 |
| InChI | InChI=1S/C11H15N.C5H10N2O3/c1-2-5-10(6-3-1)9-11-7-4-8-12-11;1-3(9)4(5(6)10)7-2-8/h1-3,5-6,11-12H,4,7-9H2;2-4,9H,1H3,(H2,6,10)(H,7,8) |
| InChIKey | WKHVZXUYKWHYRN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|