About but-3-en-2-imine;ethane;N-methylpiperidin-4-amine
but-3-en-2-imine;ethane;N-methylpiperidin-4-amine (PubChem CID 145006356) has the molecular formula C12H27N3
and a molecular weight of 213.37 g/mol. Its IUPAC name is but-3-en-2-imine;ethane;N-methylpiperidin-4-amine.
Molecular Properties
| Compound Name | but-3-en-2-imine;ethane;N-methylpiperidin-4-amine |
| PubChem CID | 145006356 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | but-3-en-2-imine;ethane;N-methylpiperidin-4-amine |
| SMILES | CC.CNC1CCNCC1.[H]/N=C(\C)C=C |
| InChI | InChI=1S/C6H14N2.C4H7N.C2H6/c1-7-6-2-4-8-5-3-6;1-3-4(2)5;1-2/h6-8H,2-5H2,1H3;3,5H,1H2,2H3;1-2H3/b;5-4+; |
| InChIKey | BULMGYXSSWSIEL-YHVJRZKVSA-N |
| XLogP | 2.20 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-imine;ethane;N-methylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-imine;ethane;N-methylpiperidin-4-amine?
The IUPAC name of but-3-en-2-imine;ethane;N-methylpiperidin-4-amine (CID 145006356) is but-3-en-2-imine;ethane;N-methylpiperidin-4-amine.
What is the SMILES notation for but-3-en-2-imine;ethane;N-methylpiperidin-4-amine?
The canonical SMILES for but-3-en-2-imine;ethane;N-methylpiperidin-4-amine is CC.CNC1CCNCC1.[H]/N=C(\C)C=C.
What is the InChIKey of but-3-en-2-imine;ethane;N-methylpiperidin-4-amine?
The InChIKey is BULMGYXSSWSIEL-YHVJRZKVSA-N. The full InChI is InChI=1S/C6H14N2.C4H7N.C2H6/c1-7-6-2-4-8-5-3-6;1-3-4(2)5;1-2/h6-8H,2-5H2,1H3;3,5H,1H2,2H3;1-2H3/b;5-4+;.
What are the key properties of but-3-en-2-imine;ethane;N-methylpiperidin-4-amine?
but-3-en-2-imine;ethane;N-methylpiperidin-4-amine has a molecular weight of 213.37 g/mol, XLogP of 2.20, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-imine;ethane;N-methylpiperidin-4-amine is sourced from PubChem (CID 145006356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).