C12H23N3 — CID 91180569
N,N-dimethyl-2-(1-methylpiperidin-4-yl)iminobut-3-en-1-amine (PubChem CID 91180569) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N,N-dimethyl-2-(1-methylpiperidin-4-yl)iminobut-3-en-1-amine.
| Compound Name | N,N-dimethyl-2-(1-methylpiperidin-4-yl)iminobut-3-en-1-amine |
|---|---|
| PubChem CID | 91180569 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N,N-dimethyl-2-(1-methylpiperidin-4-yl)iminobut-3-en-1-amine |
| SMILES | C=C/C(CN(C)C)=N\C1CCN(C)CC1 |
| InChI | InChI=1S/C12H23N3/c1-5-11(10-14(2)3)13-12-6-8-15(4)9-7-12/h5,12H,1,6-10H2,2-4H3/b13-11+ |
| InChIKey | JBCPKPIBQKCEBH-ACCUITESSA-N |
| XLogP | 1.27 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|