C21H26ClF3N2O2 — CID 145010905
1-[[[(8-chloro-3-cyclobutylindolizin-1-yl)-hydroxymethyl]amino]methyl]-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 145010905) has the molecular formula C21H26ClF3N2O2 and a molecular weight of 430.90 g/mol. Its IUPAC name is 1-[[[(8-chloro-3-cyclobutylindolizin-1-yl)-hydroxymethyl]amino]methyl]-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[[[(8-chloro-3-cyclobutylindolizin-1-yl)-hydroxymethyl]amino]methyl]-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 145010905 |
| Molecular Formula | C21H26ClF3N2O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-[[[(8-chloro-3-cyclobutylindolizin-1-yl)-hydroxymethyl]amino]methyl]-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC(NCC1(O)CCCC(C(F)(F)F)C1)c1cc(C2CCC2)n2cccc(Cl)c12 |
| InChI | InChI=1S/C21H26ClF3N2O2/c22-16-7-3-9-27-17(13-4-1-5-13)10-15(18(16)27)19(28)26-12-20(29)8-2-6-14(11-20)21(23,24)25/h3,7,9-10,13-14,19,26,28-29H,1-2,4-6,8,11-12H2 |
| InChIKey | RMWOTQJZALCLRT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|