C12H23NO — CID 145012043
ethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine (PubChem CID 145012043) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is ethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine.
| Compound Name | ethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine |
|---|---|
| PubChem CID | 145012043 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]morpholine |
| SMILES | C/C=C\C(=C/C)C1COCCN1.CC |
| InChI | InChI=1S/C10H17NO.C2H6/c1-3-5-9(4-2)10-8-12-7-6-11-10;1-2/h3-5,10-11H,6-8H2,1-2H3;1-2H3/b5-3-,9-4+; |
| InChIKey | HDTJANQPIVSAQR-XNDFSMPPSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|