C14H23N — CID 145012056
2-[(6Z)-4-methyl-5-methylideneocta-1,6-dien-3-yl]pyrrolidine (PubChem CID 145012056) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 2-[(6Z)-4-methyl-5-methylideneocta-1,6-dien-3-yl]pyrrolidine.
| Compound Name | 2-[(6Z)-4-methyl-5-methylideneocta-1,6-dien-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 145012056 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 2-[(6Z)-4-methyl-5-methylideneocta-1,6-dien-3-yl]pyrrolidine |
| SMILES | C=CC(C1CCCN1)C(C)C(=C)/C=C\C |
| InChI | InChI=1S/C14H23N/c1-5-8-11(3)12(4)13(6-2)14-9-7-10-15-14/h5-6,8,12-15H,2-3,7,9-10H2,1,4H3/b8-5- |
| InChIKey | CCAVFCYZFRUHLF-YVMONPNESA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|