C9H13N3O — CID 145012317
6-(1-methoxyethenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine (PubChem CID 145012317) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 6-(1-methoxyethenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine.
| Compound Name | 6-(1-methoxyethenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 145012317 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 6-(1-methoxyethenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine |
| SMILES | C=C(OC)C1Cc2nc[nH]c2CN1 |
| InChI | InChI=1S/C9H13N3O/c1-6(13-2)7-3-8-9(4-10-7)12-5-11-8/h5,7,10H,1,3-4H2,2H3,(H,11,12) |
| InChIKey | HSSOQGHTROPZJW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|