C2H6N4O — CID 145012716
N,N'-diamino-2-oxoethanimidamide (PubChem CID 145012716) has the molecular formula C2H6N4O and a molecular weight of 102.10 g/mol. Its IUPAC name is N,N'-diamino-2-oxoethanimidamide.
| Compound Name | N,N'-diamino-2-oxoethanimidamide |
|---|---|
| PubChem CID | 145012716 |
| Molecular Formula | C2H6N4O |
| Molecular Weight | 102.10 g/mol |
| Exact Mass | 102.05 |
| IUPAC Name | N,N'-diamino-2-oxoethanimidamide |
| SMILES | N/N=C(/C=O)NN |
| InChI | InChI=1S/C2H6N4O/c3-5-2(1-7)6-4/h1H,3-4H2,(H,5,6) |
| InChIKey | BMUJIFYWGWKTBD-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.10 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|