C6H12N2O — CID 123980775
N,N'-diethyl-2-oxoethanimidamide (PubChem CID 123980775) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is N,N'-diethyl-2-oxoethanimidamide.
| Compound Name | N,N'-diethyl-2-oxoethanimidamide |
|---|---|
| PubChem CID | 123980775 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | N,N'-diethyl-2-oxoethanimidamide |
| SMILES | CC/N=C(\C=O)NCC |
| InChI | InChI=1S/C6H12N2O/c1-3-7-6(5-9)8-4-2/h5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | YQGZUQFABZSMCB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|