C12H27BrN4S2 — CID 54604706
2-(N,N'-diethylcarbamimidoyl)sulfanylethyl N,N'-diethylcarbamimidothioate;hydrobromide (PubChem CID 54604706) has the molecular formula C12H27BrN4S2 and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-(N,N'-diethylcarbamimidoyl)sulfanylethyl N,N'-diethylcarbamimidothioate;hydrobromide.
| Compound Name | 2-(N,N'-diethylcarbamimidoyl)sulfanylethyl N,N'-diethylcarbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 54604706 |
| Molecular Formula | C12H27BrN4S2 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-(N,N'-diethylcarbamimidoyl)sulfanylethyl N,N'-diethylcarbamimidothioate;hydrobromide |
| SMILES | Br.CC/N=C(/NCC)SCCS/C(=N/CC)NCC |
| InChI | InChI=1S/C12H26N4S2.BrH/c1-5-13-11(14-6-2)17-9-10-18-12(15-7-3)16-8-4;/h5-10H2,1-4H3,(H,13,14)(H,15,16);1H |
| InChIKey | ZJMPLNSYINPVMZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|