C6H13IN2 — CID 135291555
N,N'-diethyl-2-iodoethanimidamide (PubChem CID 135291555) has the molecular formula C6H13IN2 and a molecular weight of 240.09 g/mol. Its IUPAC name is N,N'-diethyl-2-iodoethanimidamide.
| Compound Name | N,N'-diethyl-2-iodoethanimidamide |
|---|---|
| PubChem CID | 135291555 |
| Molecular Formula | C6H13IN2 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | N,N'-diethyl-2-iodoethanimidamide |
| SMILES | CC/N=C(\CI)NCC |
| InChI | InChI=1S/C6H13IN2/c1-3-8-6(5-7)9-4-2/h3-5H2,1-2H3,(H,8,9) |
| InChIKey | KSALPQMHYIPWJG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|