C11H26N6 — CID 176541502
1-[[bis(ethylamino)methylideneamino]methyl]-2,3-diethylguanidine (PubChem CID 176541502) has the molecular formula C11H26N6 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-[[bis(ethylamino)methylideneamino]methyl]-2,3-diethylguanidine.
| Compound Name | 1-[[bis(ethylamino)methylideneamino]methyl]-2,3-diethylguanidine |
|---|---|
| PubChem CID | 176541502 |
| Molecular Formula | C11H26N6 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1-[[bis(ethylamino)methylideneamino]methyl]-2,3-diethylguanidine |
| SMILES | CC/N=C(\NCC)NCN=C(NCC)NCC |
| InChI | InChI=1S/C11H26N6/c1-5-12-10(13-6-2)16-9-17-11(14-7-3)15-8-4/h5-9H2,1-4H3,(H2,12,13,16)(H2,14,15,17) |
| InChIKey | QOPVYKCSYZGLHK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|