About 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride
2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride (PubChem CID 45260207) has the molecular formula C16H20Cl2N2
and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride |
| PubChem CID | 45260207 |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride |
| SMILES | CC/N=C(/Cc1ccc2ccccc2c1Cl)NCC.Cl |
| InChI | InChI=1S/C16H19ClN2.ClH/c1-3-18-15(19-4-2)11-13-10-9-12-7-5-6-8-14(12)16(13)17;/h5-10H,3-4,11H2,1-2H3,(H,18,19);1H |
| InChIKey | VJWKQWYDWWVTGQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride?
The IUPAC name of 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride (CID 45260207) is 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride.
What is the SMILES notation for 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride?
The canonical SMILES for 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride is CC/N=C(/Cc1ccc2ccccc2c1Cl)NCC.Cl.
What is the InChIKey of 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride?
The InChIKey is VJWKQWYDWWVTGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2.ClH/c1-3-18-15(19-4-2)11-13-10-9-12-7-5-6-8-14(12)16(13)17;/h5-10H,3-4,11H2,1-2H3,(H,18,19);1H.
What are the key properties of 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride?
2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride has a molecular weight of 311.26 g/mol, XLogP of 4.49, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride is sourced from PubChem (CID 45260207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).