C16H20Cl2N2 — CID 45260207
2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride (PubChem CID 45260207) has the molecular formula C16H20Cl2N2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride.
| Compound Name | 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 45260207 |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(1-chloronaphthalen-2-yl)-N,N'-diethylethanimidamide;hydrochloride |
| SMILES | CC/N=C(/Cc1ccc2ccccc2c1Cl)NCC.Cl |
| InChI | InChI=1S/C16H19ClN2.ClH/c1-3-18-15(19-4-2)11-13-10-9-12-7-5-6-8-14(12)16(13)17;/h5-10H,3-4,11H2,1-2H3,(H,18,19);1H |
| InChIKey | VJWKQWYDWWVTGQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|