About N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide
N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide (PubChem CID 164646497) has the molecular formula C10H14BrN3
and a molecular weight of 256.15 g/mol. Its IUPAC name is N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide.
Molecular Properties
| Compound Name | N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide |
| PubChem CID | 164646497 |
| Molecular Formula | C10H14BrN3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide |
| SMILES | CC/N=C(/Cc1ccccc1Br)NN |
| InChI | InChI=1S/C10H14BrN3/c1-2-13-10(14-12)7-8-5-3-4-6-9(8)11/h3-6H,2,7,12H2,1H3,(H,13,14) |
| InChIKey | BYYBMWBAPVLGJE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide?
The IUPAC name of N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide (CID 164646497) is N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide.
What is the SMILES notation for N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide?
The canonical SMILES for N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide is CC/N=C(/Cc1ccccc1Br)NN.
What is the InChIKey of N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide?
The InChIKey is BYYBMWBAPVLGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN3/c1-2-13-10(14-12)7-8-5-3-4-6-9(8)11/h3-6H,2,7,12H2,1H3,(H,13,14).
What are the key properties of N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide?
N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide has a molecular weight of 256.15 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-2-(2-bromophenyl)-N'-ethylethanimidamide is sourced from PubChem (CID 164646497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).