C14H21BrN2O2S — CID 8774908
(2-bromo-4,5-dimethoxyphenyl)methyl N,N'-diethylcarbamimidothioate (PubChem CID 8774908) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)methyl N,N'-diethylcarbamimidothioate.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)methyl N,N'-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 8774908 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)methyl N,N'-diethylcarbamimidothioate |
| SMILES | CC/N=C(\NCC)SCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C14H21BrN2O2S/c1-5-16-14(17-6-2)20-9-10-7-12(18-3)13(19-4)8-11(10)15/h7-8H,5-6,9H2,1-4H3,(H,16,17) |
| InChIKey | SHKUKTWQHVBJLD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|