C13H16BrNO3 — CID 9207575
2-(2-bromo-4,5-dimethoxyphenyl)-N-prop-2-enylacetamide (PubChem CID 9207575) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-N-prop-2-enylacetamide.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 9207575 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C13H16BrNO3/c1-4-5-15-13(16)7-9-6-11(17-2)12(18-3)8-10(9)14/h4,6,8H,1,5,7H2,2-3H3,(H,15,16) |
| InChIKey | FYRXIZVVHDSBNV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|