C16H24BrN3O4S — CID 111140681
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine (PubChem CID 111140681) has the molecular formula C16H24BrN3O4S and a molecular weight of 434.36 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111140681 |
| Molecular Formula | C16H24BrN3O4S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1Br)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24BrN3O4S/c1-4-18-16(20-12-5-6-25(21,22)10-12)19-9-11-7-14(23-2)15(24-3)8-13(11)17/h7-8,12H,4-6,9-10H2,1-3H3,(H2,18,19,20) |
| InChIKey | YTAHMUPXOMWUMZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|